| Identification | |
| Name: | Propanoic acid,3-[acetyl(3-amino-2,4,6-triiodophenyl)amino]-2-methyl- |
| Synonyms: | b-Alanine,N-acetyl-N-(3-amino-2,4,6-triiodophenyl)-2-methyl- (8CI); Cholebrine; Cholimil;DRC 1201; Iocetamic acid; MP 620;N-(3-Amino-2,4,6-triiodophenyl)-3-acetamido-2-methylpropionic acid;N-Acetyl-N-(3-amino-2,4,6-triiodophenyl)-2-methyl-b-alanine; N-Acetyl-N-(3-amino-2,4,6-triiodophenyl)-b-aminoisobutyric acid |
| CAS: | 16034-77-8 |
| EINECS: | 240-173-1 |
| Molecular Formula: | C12H13 I3 N2 O3 |
| Molecular Weight: | 613.95663 |
| InChI: | InChI=1S/C12H13I3N2O3/c1-5(12(19)20)4-17(6(2)18)11-8(14)3-7(13)10(16)9(11)15/h3,5H,4,16H2,1-2H3,(H,19,20) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 224-225 DEG C |
| Flash Point: | 351.9°C |
| Boiling Point: | 658.2°C at 760 mmHg |
| Density: | 2.416g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.75 |
| Water Solubility: | Stability Stable. Incompatible with strong oxidizing agents. Toxicology May be harmful or act as an irritant. Toxicology notfully investigated. Toxicity data ( |
| Solubility: |
|
| Specification: |
Iocetamic acid (16034-77-8),which also can be called for Iocetamic acid (200 mg) ; 3-(Acetyl(3-amino-2,4,6-triiodophenyl)amino)-2-methyl-propanoicaci ; 3-(Acetyl-(3-amino-2,4,6-triiodophenyl)amino)-2-methylpropanoicacid ; 3-(Acetyl-(3-amino-2,4,6-triiodophenyl)amino)-2-methyl-propionicaci ; Cholebrine ; Cholimil ; Colebrina ; DRC1201 .When Iocetamic acid (16034-77-8) was heated,it emits toxic vapors of NOx and I− .This chemical is stable and incompatible with strong oxidizing agents. |
| Flash Point: | 351.9°C |
| Color: | WHITE TO LIGHT CREAM-COLORED POWDER |
| Safety Data | |
| Hazard Symbols | |
 |
|
