| Identification |
| Name: | 1-Anthracenediazonium,9,10-dihydro-9,10-dioxo- |
| Synonyms: | 1-Diazonium-9,10-anthraquinone;9,10-Anthraquinone-1-diazonium; 9,10-Dioxo-1-anthracenediazonium; BrentamineFast Red AL Salt; C.I. 37275; C.I. Azoic Diazo Component 36; Fast Red AL; FastRed AL Salt; Fast Red Salt AL |
| CAS: | 16048-40-1 |
| EINECS: | 240-193-0 |
| Molecular Formula: | C14H7 N2 O2 |
| Molecular Weight: | 235.21758 |
| InChI: | InChI=1S/C14H7N2O2/c15-16-11-7-3-6-10-12(11)14(18)9-5-2-1-4-8(9)13(10)17/h1-7H/q+1 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Water Solubility: | Stability Stable. Incompatible with strong oxidizing agents. Toxicology May be harmful or act as an irritant - toxicologynot fully investigated. Toxicity data ( |
| Solubility: | |
| Appearance: | tan to green powder |
| Flash Point: | °C |
| Safety Data |
| |
 |
