| Identification | |
| Name: | Benzene,1,4-bis(1-methylethenyl)- |
| Synonyms: | Benzene,p-diisopropenyl- (6CI,7CI,8CI); 1,4-Bis(1-methylvinyl)benzene;1,4-Diisopropenylbenzene; NSC 84197; p-Diisopropenylbenzene |
| CAS: | 1605-18-1 |
| EINECS: | 216-515-0 |
| Molecular Formula: | C12H14 |
| Molecular Weight: | 158.26 |
| InChI: | InChI=1/C12H14/c1-9(2)11-5-7-12(8-6-11)10(3)4/h5-8H,1,3H2,2,4H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 65°C |
| Flash Point: | 93.3°C |
| Boiling Point: | 239.9°Cat760mmHg |
| Density: | 0.873g/cm3 |
| Refractive index: | 1.515 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 93.3°C |
| Safety Data | |
 |
|
