| Identification | |
| Name: | Phosphine,diethylphenyl- |
| Synonyms: | Diethylphenylphosphine;NSC 158475;Phenyldiethylphosphine; |
| CAS: | 1605-53-4 |
| EINECS: | 216-516-6 |
| Molecular Formula: | C10H15P |
| Molecular Weight: | 166.20 |
| InChI: | InChI=1/C10H15P/c1-3-11(4-2)10-8-6-5-7-9-10/h5-9H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN3278 |
| Refractive index: | n20/D 1.546(lit.) |
| Appearance: | irritable\smell \colorless liquid |
| Specification: | Safety Statements:17-26-36 17:Keep away from combustible material 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Packinggroup: | III |
| Sensitive: | Air & Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
