Identification |
Name: | 3-Pyridinecarboxylicacid, 4-amino-, methyl ester |
Synonyms: | Methyl 4-aminonicotinate;4-Aminopyridine-3-carboxylic acid methyl ester;4-Aminonicotinic acid methyl ester;Nicotinicacid, 4-amino-, methyl ester (6CI,8CI); |
CAS: | 16135-36-7 |
Molecular Formula: | C7H8N2O2 |
Molecular Weight: | 152.15 |
InChI: | InChI=1/C7H8N2O2/c1-11-7(10)5-4-9-3-2-6(5)8/h2-4H,1H3,(H2,8,9) |
Molecular Structure: |
|
Properties |
Density: | 1.238g/cm3 |
Refractive index: | 1.57 |
Specification: |
The extinguishing agent of 4-Aminonicotinic acid methyl ester (CAS No.16135-36-7) are dry powder, foam, sand, carbon dioxide, water mist.
|
Safety Data |
|
|