| Identification | |
| Name: | 3-Pyridinecarboxylicacid, 4-amino-, methyl ester |
| Synonyms: | Methyl 4-aminonicotinate;4-Aminopyridine-3-carboxylic acid methyl ester;4-Aminonicotinic acid methyl ester;Nicotinicacid, 4-amino-, methyl ester (6CI,8CI); |
| CAS: | 16135-36-7 |
| Molecular Formula: | C7H8N2O2 |
| Molecular Weight: | 152.15 |
| InChI: | InChI=1/C7H8N2O2/c1-11-7(10)5-4-9-3-2-6(5)8/h2-4H,1H3,(H2,8,9) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.238g/cm3 |
| Refractive index: | 1.57 |
| Specification: |
The extinguishing agent of 4-Aminonicotinic acid methyl ester (CAS No.16135-36-7) are dry powder, foam, sand, carbon dioxide, water mist. |
| Safety Data | |
 |
|
