| Identification | |
| Name: | Quinuclidin-3-ol |
| Synonyms: | 1-Azabicyclo[2.2.2]octan-3-ol; 3-Quinuclidinol; 3-Hydroxyquinuclidine; 3-HYDROXYCHINUCLIDIN; 3-HYDROXYQUINUELIDINE; 3-Hydroxy-1-azabicyclo[2.2.2]octane; Quinuclidine-3-ol; Quinuclidinol |
| CAS: | 1619-34-7 |
| EINECS: | 216-578-4 |
| Molecular Formula: | C7H13NO |
| Molecular Weight: | 127.18 |
| InChI: | InChI=1/C7H13NO/c9-7-5-8-3-1-6(7)2-4-8/h6-7,9H,1-5H2 |
| Molecular Structure: | ![(C7H13NO) 1-Azabicyclo[2.2.2]octan-3-ol; 3-Quinuclidinol; 3-Hydroxyquinuclidine; 3-HYDROXYCHINUCLIDIN; 3-HYDRO...](https://img.guidechem.com/casimg/1619-34-7.gif) |
| Properties | |
| Transport: | UN 3263 |
| Density: | 1.13g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | soluble |
| Solubility: | soluble |
| Appearance: | Almost white crystalline powder. |
| Specification: |
3-Quinuclidinol , its CAS NO. is 1619-34-7, the synonyms are 3-Quinuclidinol dl-form ; Quinuclidinol ; 1-Azabicyclo(2.2.2)octan-3-ol Quinuclidin-3-ol ; 3-Hydroxyquinuclidine . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Storage Temperature: | 2-8°C |
| Color: | Cream colored crystalline powder Crystals form in ethanol Crystals form in benzene |
| Usage: |
3-Quinuclidinol (CAS NO.1619-34-7) is used as synthon for preparation of cholinergic receptor ligands and anesthetics. |
| Safety Data | |
| Hazard Symbols |
F:Flammable
C:Corrosive
|
 |
|
