| Identification | |
| Name: | Cyclopentanecarbonitrile,1-amino-, hydrochloride (1:1) |
| Synonyms: | Cyclopentanecarbonitrile,1-amino-, hydrochloride (7CI);Cyclopentanecarbonitrile, 1-amino-, monohydrochloride(8CI,9CI);1-Amino-1-cyanocyclopentane hydrochloride; |
| CAS: | 16195-83-8 |
| Molecular Formula: | C6H10N2.HCl |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C6H10N2.ClH/c7-5-6(8)3-1-2-4-6;/h1-4,8H2;1H |
| Molecular Structure: |  |
| Properties | |
| Specification: |
The 1-Aminocyclopentanecarbonitrile hydrochloride, with the cas registry number 16195-83-8, is also called 1-aminocyclopentane carbonitrile, HCl. It belongs to the product category of Cycloalkanes. And the molecular formula of the chemical is C6H10N2.HCl. The characteristics of this chemical are as followings: (1)# of Rule of 5 Violations: 0; (2)ACD/BCF (pH 5.5): 1; (3)ACD/BCF (pH 7.4): 1; (4)ACD/KOC (pH 5.5): 12.29; (5)ACD/KOC (pH 7.4): 18.07; (6)#H bond acceptors: 2; (7)#H bond donors: 2; (8)#Freely Rotating Bonds: 1; (9)Polar Surface Area: 49.81 Å2; (10)Flash Point: 107.7 °C; (11)Enthalpy of Vaporization: 50.19 kJ/mol; (12)Boiling Point: 254.5 °C at 760 mmHg; (13)Vapour Pressure: 0.0136 mmHg at 25°C. Addtionally, the following datas could be converted into the molecular structure: |
| Safety Data | |
 |
|
