| Identification | |
| Name: | 2-Propanone,1-(diethylamino)- |
| Synonyms: | 2-Propanone,(diethylamino)- (6CI,7CI); (Diethylamino)acetone; 1-(Diethylamino)-2-propanone;NSC 61985 |
| CAS: | 1620-14-0 |
| EINECS: | 216-583-1 |
| Molecular Formula: | C7H15 N O |
| Molecular Weight: | 129.2 |
| InChI: | InChI=1/C7H15NO/c1-4-8(5-2)6-7(3)9/h4-6H2,1-3H3/p+1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1224 3/PG 3 |
| Flash Point: | 38.3°C |
| Boiling Point: | 168.2°Cat760mmHg |
| Density: | 0.87g/cm3 |
| Refractive index: | n20/D 1.425(lit.) |
| Specification: | clear yellow to brown liquid Safety Statements:16-26-36/37/39 16:Keep away from sources of ignition - No smoking 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Packinggroup: | III |
| Flash Point: | 38.3°C |
| Storage Temperature: | 0-6°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
C: Corrosive
|
 |
|
