Identification |
Name: | Estra-1,3,5(10)-trien-17-one,3-methoxy- |
Synonyms: | (+)-Estrone3-methyl ether;(+)-Estrone methyl ether;3-Methoxyestra-1,3,5(10)-trien-17-one;3-Methoxyestra-1,3,5(10)triene-17-one;3-Methoxyestra-1,3,5-trien-17-one;3-Methoxyestrone;3-Methoxyoestra-1,3,5(10)-trien-17-one;3-O-Methylestrone;Estrone methyl ether;NSC 88911;Oestrone methyl ether; |
CAS: | 1624-62-0 |
EINECS: | 216-613-3 |
Molecular Formula: | C19H24O2 |
Molecular Weight: | 284.39 |
InChI: | InChI=1/C19H24O2/c1-19-10-9-15-14-6-4-13(21-2)11-12(14)3-5-16(15)17(19)7-8-18(19)20/h4,6,11,15-17H,3,5,7-10H2,1-2H3/t15-,16-,17+,19+/m1/s1 |
Molecular Structure: |
|
Properties |
Melting Point: | 167.5-169.5ºC |
Density: | 1.103 g/cm3 |
Refractive index: | 1.556 |
Water Solubility: | Soluble in chloroform and hydrochloride |
Solubility: | Soluble in chloroform and hydrochloride |
Appearance: | White crystalline powder |
Safety Data |
Hazard Symbols |
Xn:Harmful
|
|
|