| Identification | |
| Name: | L-Cysteine,S-[(phenylmethoxy)carbonyl]- |
| Synonyms: | Cysteine,benzyl carbonate (ester), L- (6CI,7CI,8CI); L-Cysteine, phenylmethyl carbonate(ester) (9CI); Carbonic acid, thio-, O-benzyl ester, S-ester with L-cysteine(7CI,8CI); NSC 88493; S-CBz-L-cysteine; S-Carbobenzoxy-cysteine;S-Carbobenzoxycysteine; S-Carbobenzyloxy-L-cysteine; S-Carboxybenzyl-L-cysteine |
| CAS: | 1625-72-5 |
| Molecular Formula: | C11H13 N O4 S |
| Molecular Weight: | 255.29 |
| InChI: | InChI=1/C11H13NO4S/c12-9(10(13)14)7-17-11(15)16-6-8-4-2-1-3-5-8/h1-5,9H,6-7,12H2,(H,13,14) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 217.2°C |
| Boiling Point: | 435.6°Cat760mmHg |
| Density: | 1.358g/cm3 |
| Refractive index: | 1.602 |
| Specification: |
S-Cbz-L-cysteine , its cas register number is 1625-72-5. It also can be called S-Carbobenzoxy-L-cysteine ; L-Cysteine(Z)-OH ; H-Cys(Z)-OH ; L-Cysteine,S-[(phenylmethoxy)carbonyl]- . |
| Flash Point: | 217.2°C |
| Storage Temperature: | −20°C |
| Safety Data | |
 |
|
