| Identification | |
| Name: | Benzene,[(dimethylsilyl)methyl]- |
| Synonyms: | Silane,benzyldimethyl- (6CI,7CI,8CI); Silane, dimethyl(phenylmethyl)- (9CI);Benzyldimethylhydrosilane; Benzyldimethylsilane; NSC 155373 |
| CAS: | 1631-70-5 |
| EINECS: | -0 |
| Molecular Formula: | C9H14 Si |
| Molecular Weight: | 150.29 |
| InChI: | InChI=1/C9H14Si/c1-10(2)8-9-6-4-3-5-7-9/h3-7,10H,8H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993 |
| Density: | 0.949 |
| Refractive index: | 1.502 |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Packinggroup: | III |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
