Identification |
Name: | Benzene,[(dimethylsilyl)methyl]- |
Synonyms: | Silane,benzyldimethyl- (6CI,7CI,8CI); Silane, dimethyl(phenylmethyl)- (9CI);Benzyldimethylhydrosilane; Benzyldimethylsilane; NSC 155373 |
CAS: | 1631-70-5 |
EINECS: | -0 |
Molecular Formula: | C9H14 Si |
Molecular Weight: | 150.29 |
InChI: | InChI=1/C9H14Si/c1-10(2)8-9-6-4-3-5-7-9/h3-7,10H,8H2,1-2H3 |
Molecular Structure: |
 |
Properties |
Transport: | UN 1993 |
Density: | 0.949 |
Refractive index: | 1.502 |
Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36:Wear suitable protective clothing |
Packinggroup: | III |
Safety Data |
Hazard Symbols |
Xi:Irritant
|
|
 |