| Identification | |
| Name: | 1,4-Butane sultone |
| Synonyms: | 4-Hydroxy-1-butanesulfonic acid delta-sultone; Butanesultone; 1,4-Butanesultone; 4-Hydroxy-1-butanesulphonic acid sultone; 1,4-butane sulfone |
| CAS: | 1633-83-6 |
| EINECS: | 216-647-9 |
| Molecular Formula: | C4H8O3S |
| Molecular Weight: | 136.16 |
| InChI: | InChI=1/C4H8O3S/c5-8(6)4-2-1-3-7-8/h1-4H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2810 |
| Density: | 1.331 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.46-1.464 |
| Appearance: | clear colorless to yellowish liquid |
| Specification: |
?1,4-Butane sultone , its cas register number is 1633-83-6. It also can be called 4-Hydroxy-1-butanesulfonic acid delta-sultone ; and Butanesultone . |
| Report: |
EPA Genetic Toxicology Program. Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29349990 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Moisture Sensitive |
| Usage: | Research chemical (alkylating agent). |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
