| Identification |
| Name: | 4-Ethylbenzoyl chloride |
| Synonyms: | PEBC; 4-ETHYLBENZENE-1-CARBONYL CHLORIDE; TIMTEC-BB SBB006540; P-ETHYLBENZOYL CHLORIDE; Benzoyl chloride, 4-ethyl-; ETHYLBENZOYL CHLORIDE; PenicillinGProcaineSterileBp98; Benzoyl chloride, 4-ethyl- (9CI); 4-Ethylbenzoyl choride |
| CAS: | 16331-45-6 |
| EINECS: | 240-404-6 |
| Molecular Formula: | C9H9ClO |
| Molecular Weight: | 168.62 |
| InChI: | InChI=1/C9H9ClO/c1-2-7-3-5-8(6-4-7)9(10)11/h3-6H,2H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3265 8 |
| Melting Point: | 42 - 43 |
| Density: | 1.14 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.5465-1.5485 |
| Water Solubility: | Soluble in tolene, chloroform etc |
| Solubility: | Soluble in tolene, chloroform etc |
| Appearance: | Colourless or pale yellow liquid |
| Packinggroup: | II |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. Corrosives area. Store protected from moisture. |
| Sensitive: | Moisture Sensitive |
| Usage: | Intermediates of Liquid Crystals |
| Safety Data |
| Hazard Symbols |
C:Corrosive
|
| |
 |
