| Identification | |
| Name: | Thioperoxydicarbonicdiamide ([(H2N)C(S)]2S2), N,N,N',N'-tetrabutyl- |
| Synonyms: | NSC 677476;Disulfide,bis(dibutylthiocarbamoyl) (6CI,7CI,8CI);Thioperoxydicarbonic diamide ([(H2N)C(S)]2S2),tetrabutyl- (9CI);Bis(dibutylthiocarbamoyl) disulfide;Butyl Tuads;E-BT 55;Methanethioamide, 1,1'-dithiobis[N,N-dibutyl-;N,N,N',N'-Tetrabutylthiuramdisulfide;Robac TBUT;Tetrabutylthiuram disulfide;Nocceler TBT;Nocceler TBT-N;1,1',1'',1'''-[Disulfanediylbis(carbonothioylnitrilo)]tetrabutane;Bis-(dibutylthiocarbamoyl) disulfide;butane, 1,1',1'',1'''-[dithiobis(carbonothioylnitrilo)]tetrakis-; |
| CAS: | 1634-02-2 |
| EINECS: | 216-652-6 |
| Molecular Formula: | C18H36N2S4 |
| Molecular Weight: | 408.75 |
| InChI: | InChI=1/C18H36N2S4/c1-5-9-13-19(14-10-6-2)17(21)23-24-18(22)20(15-11-7-3)16-12-8-4/h5-16H2,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 243.2°C |
| Boiling Point: | 478.5°Cat760mmHg |
| Density: | 1.081g/cm3 |
| Refractive index: | 1.566 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 243.2°C |
| Safety Data | |
 |
|
