| Identification |
| Name: | Piperidine,4-(1H-imidazol-5-ylmethyl)-, hydrobromide (1:2) |
| Synonyms: | Piperidine,4-(1H-imidazol-4-ylmethyl)-, dihydrobromide (9CI);4-(1H-Imidazol-4-ylmethyl)piperidine dihydrobromide; Immepip hydrobromide |
| CAS: | 164391-47-3 |
| Molecular Formula: | C9H15 N3 . 2 Br H |
| Molecular Weight: | 327.06 |
| InChI: | InChI=1/C9H15N3.2BrH/c1-3-10-4-2-8(1)5-9-6-11-7-12-9;;/h6-8,10H,1-5H2,(H,11,12);2*1H |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 214°C |
| Boiling Point: | 430.2°Cat760mmHg |
| Density: | g/cm3 |
| Biological Activity: | Potent histamine H 3 receptor agonist. Also binds to H 4 receptors (K i values are 0.4 and 9 nM at human recombinant H 3 and H 4 receptors respectively). Equipotent to or slightly more active than (R)- α -methylhistamine at H 3 receptors. |
| Flash Point: | 214°C |
| Storage Temperature: | 2-8°C |
| Color: | light tan |
| Usage: | A selective nonchiral histamine H3 agonist |
| Safety Data |
| Hazard Symbols |
Xn: Harmful
|
| |
 |
