| Identification | |
| Name: | Cyclohexanecarboxylicacid, 2-oxo-, ethyl ester |
| Synonyms: | 2-(Ethoxycarbonyl)cyclohexanone;2-Carbethoxycyclohexanone;2-Carboethoxycyclohexanone;2-Oxocyclohexanecarboxylic acid ethyl ester;Ethyl1-oxo-2-cyclohexanecarboxylate;Ethyl 2-cyclohexanone-1-carboxylate;Ethyl2-oxo-1-cyclohexanecarboxylate;Ethylcyclohexanone-2-carboxylate;NSC 18744; |
| CAS: | 1655-07-8 |
| EINECS: | 216-731-5 |
| Molecular Formula: | C9H14O3 |
| Molecular Weight: | 170.2057 |
| InChI: | InChI=1/C9H14O3/c1-2-12-9(11)7-5-3-4-6-8(7)10/h7H,2-6H2,1H3/t7-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 85 ºC |
| Density: | 1.064 |
| Refractive index: | 1.4775-1.4795 |
| Appearance: | Clear colorless to pale yellow liquid |
| Specification: | Clear colorless to pale yellow liquid Safety Statements:23-24/25-37/39-26-36 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 24/25:Avoid contact with skin and eyes 37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 85 ºC |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
