| Identification | |
| Name: | 2-Pyridineethanol,2-acetate |
| Synonyms: | 2-Pyridineethanol,acetate (ester) (8CI,9CI);2-Pyridineethanol acetate;NSC 25510; |
| CAS: | 16632-09-0 |
| Molecular Formula: | C9H11NO2 |
| Molecular Weight: | 165.1891 |
| InChI: | InChI=1/C9H11NO2/c1-8(11)12-7-5-9-4-2-3-6-10-9/h2-4,6H,5,7H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.086 g/cm3 |
| Refractive index: | 1.503 |
| Specification: |
The 2-Pyridin-2-ylethyl acetate with the CAS number 16632-09-0 is also called 2-Pyridineethanol acetate. Its molecular formula is C9H11NO2. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the 2-Pyridin-2-ylethyl acetate are: (1)ACD/LogP: 0.81; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 3; (4)#H bond donors: 0; (5)#Freely Rotating Bonds: 4; (6)Polar Surface Area: 39.19Å2; (7)Index of Refraction: 1.503; (8)Molar Refractivity: 44.93 cm3; (9)Molar Volume: 151.9 cm3; (10)Polarizability: 17.81×10-24cm3; (11)Surface Tension: 40 dyne/cm; (12)Enthalpy of Vaporization: 47.96 kJ/mol; (13)Vapour Pressure: 0.0336 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
