| Identification | |
| Name: | 1,3,5-Triazin-2-amine,4-methoxy-6-methyl- |
| Synonyms: | 2-Amino-4-methoxy-6-methyl-1,3,5-triazine;2-Amino-4-methoxy-6-methyl-s-triazine;2-Amino-4-methyl-6-methoxy-s-triazine;4-Methoxy-6-methyl-1,3,5-triazin-2-amine;A 4098;CV 399;IN-A 4098;s-Triazine,2-amino-4-methoxy-6-methyl- (7CI,8CI); |
| CAS: | 1668-54-8 |
| EINECS: | 216-790-7 |
| Molecular Formula: | C5H8N4O |
| Molecular Weight: | 140.17 |
| InChI: | InChI=1S/C5H8N4O/c1-3-7-4(6)9-5(8-3)10-2/h1-2H3,(H2,6,7,8,9) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 258-261 ºC |
| Density: | 1.255 g/cm3 |
| Appearance: | White crystal |
| Specification: | off-white to light yellow powder Safety Statements:26-36-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
