Identification |
Name: | D-Ornithine monohydrochloride |
Synonyms: | D-Ornithine,monohydrochloride (9CI);Ornithine, monohydrochloride, D- (8CI);(R)-Ornithinehydrochloride;D-Ornithine,hydrochloride (1:1); |
CAS: | 16682-12-5 |
EINECS: | 240-729-3 |
Molecular Formula: | C5H12N2O2.HCl |
Molecular Weight: | 168.62 |
InChI: | InChI=1/C5H12N2O2/c6-3-1-2-4(7)5(8)9/h4H,1-3,6-7H2,(H,8,9) |
Molecular Structure: |
|
Properties |
Melting Point: | 239 °C (dec.)(lit.)
|
Flash Point: | 140.5°C |
Boiling Point: | 308.7°Cat760mmHg |
Density: | 1.165g/cm3 |
Stability: | Stable under normal temperatures and pressures. |
Appearance: | White powder. |
Flash Point: | 140.5°C |
Storage Temperature: | Store at RT. |
Usage: | An amino acid produced in the urea cycle. |
Safety Data |
|
|