| Identification | |
| Name: | Indole-5-carboxylic acid |
| Synonyms: | 1H-indole-5-carboxylate;1H-indole-5-carboxylic acid;5-Indolecarboxylic acid; |
| CAS: | 1670-81-1 |
| EINECS: | 216-799-6 |
| Molecular Formula: | C9H7NO2 |
| Molecular Weight: | 161.16 |
| InChI: | InChI=1/C9H7NO2/c11-9(12)7-1-2-8-6(5-7)3-4-10-8/h1-5,10H,(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 207.6 oC |
| Boiling Point: | 419.6 oC at 760 mmHg |
| Density: | 1.408 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Appearance: | light beige to yellow powder |
| Specification: |
?Indole-5-carboxylic acid (CAS NO.1670-81-1), its Synonyms are 2,3-Benzopyrrole-5-carboxylic acid ; 1H-indole-5-carboxylate ; 1H-indole-5-carboxylic acid ; 5-Indolecarboxylic acid . |
| HS Code: | 29339990 |
| Flash Point: | 207.6 oC |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
