| Identification | |
| Name: | Arsonamidous chloride,N,N-diphenyl- |
| Synonyms: | N,N-DIPHENYLARSONAMIDOUSCHLORIDE;DIPHENYLAMINOCHLORARSINE |
| CAS: | 16758-26-2 |
| Molecular Formula: | C12H11 As Cl N |
| Molecular Weight: | 278.60 |
| InChI: | InChI=1/C12H10AsClN/c14-13-15(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
Diphenylaminochloroarsine , its cas register number is 16758-26-2. It also can be called Arsonamidous chloride, N,N-diphenyl- ; and N,N-Diphenylarsonamidous chloride . |
| Flash Point: | °C |
| Safety Data | |
| Hazard Symbols | |
 |
|
