| Identification | |
| Name: | Ethanone,1-(4-ethoxyphenyl)- |
| Synonyms: | Acetophenone,4'-ethoxy- (6CI,7CI,8CI);1-(4-Ethoxyphenyl)ethanone;NSC 403850;NSC 406258;p-Ethoxyacetophenone;4-Ethoxyacetophenone; |
| CAS: | 1676-63-7 |
| EINECS: | 216-825-6 |
| Molecular Formula: | C10H12O2 |
| Molecular Weight: | 164.2 |
| InChI: | InChI=1/C10H12O2/c1-3-12-10-6-4-9(5-7-10)8(2)11/h4-7H,3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.016g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5429 (25 C) |
| Appearance: | Light brown - white crystals crystals. |
| Specification: | white to yellow crystals and chunks or Safety Statements:26-37/39-45-36/37-28 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 36/37:Wear suitable protective clothing and gloves 28:After contact with skin, wash immediately with plenty of ... (to be specified by the manufacturer) |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
