| Identification | |
| Name: | Benzoic acid,4-hydroxy-, potassium salt (1:1) |
| Synonyms: | Benzoicacid, 4-hydroxy-, monopotassium salt (9CI);Benzoic acid, p-hydroxy-,monopotassium salt (8CI);4-Hydroxybenzoic acid potassium salt;Monopotassiump-hydroxybenzoate;Potassium p-hydroxybenzoate;p-Hydroxybenzoic acid monopotassium salt;p-Hydroxybenzoic acid potassium salt;Potassium 4-hydroxybenzoate; |
| CAS: | 16782-08-4 |
| EINECS: | 240-830-2 |
| Molecular Formula: | C7H5KO3 |
| Molecular Weight: | 176.21 |
| InChI: | InChI=1/C7H6O3.K/c8-6-3-1-5(2-4-6)7(9)10;/h1-4,8H,(H,9,10);/q;+1/p-1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 214.5 deg C |
| Flash Point: | 171.3°C |
| Boiling Point: | 336.2°Cat760mmHg |
| Density: | 1.375g/cm3 |
| Solubility: | Solubility (in 100 g of solution): 99% ethanol 38.75 g (67 deg C); n-butanol 19.5 g (32.5 deg C) Soluble in about 125 parts water, freely in alcohol, slightly in chloroform; soluble in ether, acetone. Practically insoluble in carbon disulfide. In water, 5000 mg/L at 25 deg C |
| Flash Point: | 171.3°C |
| Color: | White granular crystalline powder consisting of monoclinic prisms |
| Safety Data | |
 |
|
