| Identification |
| Name: | 2-Amino-3-hydroxypyridine |
| Synonyms: | 2-Amino-3-pyridinol; 3-Hydroxy-2-pyridinamine; 2-Amino-3-Hydroxypyrimidine; trans-4-Aminocyclohexanol |
| CAS: | 16867-03-1 |
| EINECS: | 240-886-8 |
| Molecular Formula: | C5H6N2O |
| Molecular Weight: | 110.11 |
| InChI: | InChI=1/C5H6N2O/c6-5-4(8)2-1-3-7-5/h1-3,8H,(H2,6,7) |
| Molecular Structure: |
 |
| Properties |
| Transport: | 25kgs |
| Density: | 1.32g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Appearance: | off-white to brown powder |
| Packinggroup: | III |
| HS Code: | 29333999 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
T:Toxic
|
| |
 |
