| Identification |
| Name: | 2(1H)-Pyridinone,6-chloro- |
| Synonyms: | 2(1H)-Pyridone,6-chloro- (6CI,8CI);2-Chloro-6-pyridinol;6-Chloro-1,2-dihydropyridin-2-one;6-Chloro-2-hydroxypyridine;6-Chloro-2-pyridone;NSC 148331; |
| CAS: | 16879-02-0 |
| EINECS: | 240-909-1 |
| Molecular Formula: | C5H4ClNO |
| Molecular Weight: | 129.54 |
| InChI: | InChI=1/C5H4ClNO/c6-4-2-1-3-5(8)7-4/h1-3H,(H,7,8) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 163°C |
| Density: | 1.35 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.569 |
| Appearance: | Gray to brown solid. |
| Flash Point: | 163°C |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
