| Identification |
| Name: | Benzoic acid,3-(acetyloxy)-2-methyl- |
| Synonyms: | 3-Acetoxy-2-methylbenzoicacid;2-Methyl-3-acetoxybenzoic acid; |
| CAS: | 168899-58-9 |
| EINECS: | -0 |
| Molecular Formula: | C10H10O4 |
| Molecular Weight: | 194.19 |
| InChI: | InChI=1/C10H10O4/c1-6-8(10(12)13)4-3-5-9(6)14-7(2)11/h3-5H,1-2H3,(H,12,13) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 134.1ºC |
| Boiling Point: | 337ºC at 760 mmHg |
| Density: | 1.245 g/cm3 |
| Refractive index: | 1.545 |
| Appearance: | Almost white crystalline powder |
| Flash Point: | 134.1ºC |
| Usage: | An intermediate in the preparation of small-sized HIV protease inhibitors |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
