| Identification | |
| Name: | Ammonium hexachloroplatinate(IV) |
| Synonyms: | diammonium hexachloroplatinate; ammonium chloroplatinate |
| CAS: | 16919-58-7 |
| EINECS: | 240-973-0 |
| Molecular Formula: | (NH4)2?PtCl6 |
| Molecular Weight: | 278.17488 |
| InChI: | InChI=1S/C12H16ClNO2.ClH/c1-10-2-4-11(5-3-10)12(15)16-9-8-14-7-6-13;/h2-5,14H,6-9H2,1H3;1H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3288 |
| Melting Point: | °Cd ec.) |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | 3.07 |
| Stability: | Stable under normal temperatures and pressures. Dusts may form an explosion hazard. Boiling with Potassium hydroxide yields a product that, after drying, explodes at 205 C or when mixed with combustible materials. |
| Refractive index: | 1.95 |
| Water Solubility: | 0.7g/100ml (15ºC) in water |
| Solubility: | 0.7g/100ml (15ºC) in water |
| Appearance: | yellow powder. |
| Specification: |
Ammonium hexachloroplatinate (16919-58-7) also known as ammonium chloroplatinate and Ammonium platinic chloride , is a rare example of a soluble platinum(IV) salt that is not hygroscopic. It forms intensely yellow solutions in water. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Flash Point: | °C |
| Storage Temperature: | Store in a cool, dry, well-ventilated area away from incompatible substances. Keep containers tightly closed. |
| Sensitive: | Hygroscopic |
| Usage: | Platinum plating, manufacture spongy platinum. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
