| Identification | |
| Name: | Pyrene, 1-ethenyl- |
| Synonyms: | Pyrene,3-vinyl- (8CI); 1-Ethenylpyrene; 1-Vinylpyrene; 3-Vinylpyrene |
| CAS: | 17088-21-0 |
| Molecular Formula: | C18H12 |
| Molecular Weight: | 228.2 |
| InChI: | InChI=1/C18H12/c1-2-12-6-7-15-9-8-13-4-3-5-14-10-11-16(12)18(15)17(13)14/h2-11H,1H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 193°C |
| Boiling Point: | 409.8°Cat760mmHg |
| Density: | 1.214g/cm3 |
| Refractive index: | 1.842 |
| Specification: |
1-Ethenyl pyrene with cas registry number of 17088-21-0 is also known as 1-Vinylpyrene ; 1-Ethenylpyrene ; 3-Vinylpyrene ; Pyrene,1-ethenyl-(9CI) ; Pyrene,3-vinyl- . 1-Ethenyl pyrene can be prepared in a single reaction stage by reacting the corresponding Acetylpyrene with a metal alkoxide in an inert organic solvent, e.g. Xylene, at a temperature above 110oC. which, for some reaction conditions, optimally is between 130oC and 150oC. The presence of hydroquinone in the mixture reduces the time and increases the yield of the reaction. 1-Ethenyl pyrene with cas registry number of 17088-21-0 is used as an intermediate in synthesis of Nizatidine . |
| Flash Point: | 193°C |
| Safety Data | |
 |
|
