| Identification | |
| Name: | 3-Fluorobenzoyl chloride |
| Synonyms: | m-Fluorobenzoyl chloride |
| CAS: | 1711-07-5 |
| EINECS: | 216-977-3 |
| Molecular Formula: | C7H4ClFO |
| Molecular Weight: | 158.56 |
| InChI: | InChI=1/C7H4ClFO/c8-7(10)5-2-1-3-6(9)4-5/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3265 8 |
| Density: | 1.3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.526-1.53 |
| Water Solubility: | Decomposes in water |
| Solubility: | Decomposes in water |
| Appearance: | colorless transparent liquid |
| Specification: |
?3-Fluorobenzoyl chloride , its cas register number is 1711-07-5. It also can be called?Benzoyl chloride, m-fluoro- ; m-Fluorobenzoic acid chloride ; m-Fluorobenzoyl chloride?;?Benzoyl chloride, 3-fluoro- .It is a?clear colorless to light yellow liquid. |
| Packinggroup: | II |
| HS Code: | 29163900 |
| Storage Temperature: | Store in a tightly closed container. Corrosives area. Store protected from moisture. Store in a cool, dry area away from incompatible substances. |
| Sensitive: | Lachrymatory |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
