| Identification |
| Name: | Benzoyl chloride,3-bromo- |
| Synonyms: | Benzoylchloride, m-bromo- (6CI,7CI,8CI);3-Bromobenzoyl chloride;m-Bromobenzoyl chloride;NSC 100315; |
| CAS: | 1711-09-7 |
| EINECS: | 216-978-9 |
| Molecular Formula: | C7H4BrClO |
| Molecular Weight: | 219.46 |
| InChI: | InChI=1/C7H4BrClO/c8-6-3-1-2-5(4-6)7(9)10/h1-4H |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3265 |
| Flash Point: | 225? |
| Density: | 1.662 |
| Refractive index: | 1.595 |
| Appearance: | colorless liquid |
| Specification: | Safety Statements:26-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection 45:In case of accident or if you feel unwell, seek medical
advice immediately (show label where possible) |
| Packinggroup: | II |
| Flash Point: | 225? |
| Sensitive: | Moisture Sensitive |
| Safety Data |
| Hazard Symbols |
C:Corrosive
|
| |
 |