| Identification | |
| Name: | Propanoic acid,3-chloro-2-hydroxy- |
| CAS: | 1713-85-5 |
| EINECS: | 216-993-0 |
| Molecular Formula: | C3H5 Cl O3 |
| Molecular Weight: | 124.52 |
| InChI: | InChI=1/C3H5ClO3/c4-1-2(5)3(6)7/h2,5H,1H2,(H,6,7) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1759 |
| Flash Point: | 110.8°C |
| Boiling Point: | 259.5°Cat760mmHg |
| Density: | 1.519g/cm3 |
| Refractive index: | 1.493 |
| Specification: | White Solid Safety Statements:26-27-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 27:Take off immediately all contaminated clothing 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | III |
| Flash Point: | 110.8°C |
| Storage Temperature: | 2-8°C |
| Safety Data | |
| Hazard Symbols |
C: Corrosive
|
 |
|
