| Identification | |
| Name: | Cyclopentanecarboxylicacid, 1-[[(phenylmethoxy)carbonyl]amino]- |
| Synonyms: | Cyclopentanecarbamicacid, 1-carboxy-, N-benzyl ester (7CI,8CI);Cyclopentanecarbamic acid, 1-carboxy-,benzyl ester (6CI);1-[[(Benzyloxy)carbonyl]amino]cyclopentanecarboxylic acid;Carbobenzoxy-1-aminocyclopentane-1-carboxylic acid;N-Benzyloxycarbonylcycloleucine; |
| CAS: | 17191-44-5 |
| Molecular Formula: | C14H17NO4 |
| Molecular Weight: | 263.29 |
| InChI: | InChI=1/C14H17NO4/c16-12(17)14(8-4-5-9-14)15-13(18)19-10-11-6-2-1-3-7-11/h1-3,6-7H,4-5,8-10H2,(H,15,18)(H,16,17) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 237°C |
| Boiling Point: | 468.2°Cat760mmHg |
| Density: | 1.26g/cm3 |
| Refractive index: | 1.575 |
| Specification: |
The Cbz-1-amino-1-cyclopentanecarboxylic acid with the CAS number 17191-44-5 is also called Cyclopentanecarboxylicacid, 1-[[(phenylmethoxy)carbonyl]amino]-. The IUPAC name is 1-(phenylmethoxycarbonylamino)cyclopentane-1-carboxylic acid. Its molecular formula is C14H17NO4. This chemical belongs to the following product categories: (1)N-CBZ; (2)pharmacetical. The properties of the chemical are: (1)ACD/LogP: 2.34; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 0.56; (4)ACD/LogD (pH 7.4): -1.07; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 7.42; (8)ACD/KOC (pH 7.4): 1; (9)#H bond acceptors: 5; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 5; (12)Polar Surface Area: 55.84 Å2; (13)Index of Refraction: 1.575; (14)Molar Refractivity: 68.92 cm3; (15)Molar Volume: 208.5 cm3; (16)Polarizability: 27.32×10-24cm3; (17)Surface Tension: 54.6 dyne/cm; (18)Enthalpy of Vaporization: 76.95 kJ/mol; (19)Vapour Pressure: 1.43×10-9 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Flash Point: | 237°C |
| Safety Data | |
 |
|
