| Identification |
| Name: | Benzeneacetamide,4-hydroxy- |
| Synonyms: | Acetamide,2-(p-hydroxyphenyl)- (7CI,8CI);(4-Hydroxyphenyl)acetamide;(p-Hydroxyphenyl)acetamide;2-(4-Hydroxyphenyl)acetamide;2-(p-Hydroxyphenyl)acetamide;NSC 187193;p-(Carbamoylmethyl)phenol; |
| CAS: | 17194-82-0 |
| EINECS: | 241-235-0 |
| Molecular Formula: | C8H9 N O2 |
| Molecular Weight: | 151.16 |
| InChI: | InChI=1/C8H9NO2/c9-8(11)5-6-1-3-7(10)4-2-6/h1-4,10H,5H2,(H2,9,11) |
| Molecular Structure: |
 |
| Properties |
| Transport: | 25kgs |
| Flash Point: | STABILITY |
| Density: | 1.244g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.594 |
| Water Solubility: | soluble |
| Solubility: | Soluble AUTOIGNITION |
| Appearance: | White to beige powder |
| Flash Point: | STABILITY |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| |
 |
