| Identification | |
| Name: | 3-Cyclohexene-1-methanol,a-methyl- |
| Synonyms: | 1-(3-Cyclohexenyl)-1-ethanol;1-(3-Cyclohexenyl)ethanol |
| CAS: | 17264-01-6 |
| EINECS: | 241-294-2 |
| Molecular Formula: | C8H14 O |
| Molecular Weight: | 126.22 |
| InChI: | InChI=1/C8H14O/c1-7(9)8-5-3-2-4-6-8/h3,5,7-9H,2,4,6H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 79.5°C |
| Boiling Point: | 192.9°Cat760mmHg |
| Density: | 0.949g/cm3 |
| Refractive index: | 1.484 |
| Specification: |
(Methyl-3-cyclohexenyl)methanol with cas registry number of 17264-01-6 is also known as 1-(3-Cyclohexenyl)ethanol ; 4-06-00-00220 (Beilstein Handbook Reference) ; 3-Cyclohexene-1-methanol, alpha-methyl- (6CI,8CI,9CI) ; Methanol,methyl-3-cyclohexenyl ; alpha-Methylcyclohex-3-ene-1-methanol . |
| Flash Point: | 79.5°C |
| Safety Data | |
 |
|
