Identification |
Name: | 3-(3-(Dimethylamino)propyl)-4-hydroxy-N-(4-(4-pyridinyl)phenyl)benzamide |
Synonyms: | GR 55562 DIHYDROCHLORIDE;3-[3-(DIMETHYLAMINO)PROPYL]-4-HYDROXY-N-[4-(4-PYRIDINYL)PHENYL]BENZAMIDE DIHYDROCHLORIDE;GR555622HCl;3-(3-(Dimethylamino)propyl)-4-hydroxy-N-(4-(4-pyridinyl)phenyl)benzami de monohydrochloride;3-(3-(dimethylamino)propyl)-4-hydroxy-N-(4-(4-pyridinyl)phenyl)benzamide;GR 55562;Benzamide, 3-(3-(dimethylamino)propyl)-4-hydroxy-N-(4-(4-pyridinyl)phenyl)-, monohydrochloride |
CAS: | 172854-55-6 |
Molecular Formula: | C23H27Cl2N3O2 |
Molecular Weight: | 448.39 |
InChI: | InChI=1/C23H25N3O2/c1-26(2)15-3-4-19-16-20(7-10-22(19)27)23(28)25-21-8-5-17(6-9-21)18-11-13-24-14-12-18/h5-14,16,27H,3-4,15H2,1-2H3,(H,25,28) |
Molecular Structure: |
|
Properties |
Flash Point: | 263.2°C |
Boiling Point: | 511.6°C at 760 mmHg |
Density: | 1.192g/cm3 |
Refractive index: | 1.633 |
Biological Activity: | A selective competitive 5-HT 1B (5-HT 1D β ) silent antagonist with pK B values of 7.3 and 6.3 for human cloned 5-HT 1B and 5-HT 1D receptors respectively and only weak binding at a number of other 5-HT subtypes. |
Flash Point: | 263.2°C |
Storage Temperature: | 2-8°C |
Safety Data |
|
|