| Identification | |
| Name: | methyl 2,3-dibromopropionate |
| Synonyms: | - |
| CAS: | 1729-67-5 |
| EINECS: | 217-044-3 |
| Molecular Formula: | C4H6Br2O2 |
| Molecular Weight: | 245.9 |
| InChI: | InChI=1/C4H6Br2O2/c1-8-4(7)3(6)2-5/h3H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2398 3/PG 2 |
| Melting Point: | 8 |
| Flash Point: | 71.1°C |
| Density: | 1.944 |
| Stability: | Stable at normal temperatures and pressures. |
| Refractive index: | n20/D 1.514 |
| Solubility: | Insoluble |
| Appearance: | Clear, colorless liquid. |
| Specification: |
Propanoic acid,2,3-dibromo-, methyl ester , its cas register number is 1729-67-5. It also can be called Methyl 2,3-dibromopropanoate ; Methyl 2,3-dibromopropionate ; Methyl dibromopropionate ; Propionic acid, 2,3-dibromo-, methyl ester (8CI) .It is a clear, colorless liquid. |
| Packinggroup: | III |
| Flash Point: | 71.1°C |
| Storage Temperature: | 2-8°C |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
