| Identification | |
| Name: | Naphthalene,1,2,3,4-tetrahydro-6-methoxy- |
| Synonyms: | 1,2,3,4-Tetrahydro-6-methoxynaphthalene;2-Methoxy-5,6,7,8-tetrahydronaphthalene; 3-Methoxy-5,6,7,8-tetrahydronaphthalene;6-Methoxy-1,2,3,4-tetrahydronaphthalene; 6-Methoxytetralin;7-Methoxy-1,2,3,4-tetrahydronaphthalene; 7-Methoxy-3,4-dihydro-1H-naphthalene;NSC 28470 |
| CAS: | 1730-48-9 |
| EINECS: | 217-049-0 |
| Molecular Formula: | C11H14 O |
| Molecular Weight: | 162.23 |
| InChI: | InChI=1/C11H14O/c1-12-11-7-6-9-4-2-3-5-10(9)8-11/h6-8H,2-5H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 105.9°C |
| Boiling Point: | 278.5°Cat760mmHg |
| Density: | 1.012g/cm3 |
| Refractive index: | n20/D 1.54(lit.) |
| Specification: | CLEAR YELLOW LIQUID Safety Statements:37/39-26 37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Flash Point: | 105.9°C |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
