| Identification |
| Name: | Tridecanoic acid,methyl ester |
| Synonyms: | NSC 163375;Methyln-tridecanoate;Methyl tridecanoate; |
| CAS: | 1731-88-0 |
| EINECS: | 217-054-8 |
| Molecular Formula: | C14H28O2 |
| Molecular Weight: | 228.3709 |
| InChI: | InChI=1/C14H28O2/c1-3-4-5-6-7-8-9-10-11-12-13-14(15)16-2/h3-13H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 6-7ºC |
| Density: | 0.867 g/cm3 |
| Refractive index: | n20/D 1.435(lit.) |
| Water Solubility: | Not miscible or difficult to mix with water,Miscible with many organic solvents |
| Solubility: | Not miscible or difficult to mix with water,Miscible with many organic solvents |
| Appearance: | Colourless liquid |
| Storage Temperature: | −20°C |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |
