| Identification |
| Name: | 9H-Purin-6-amine,9-(tetrahydro-2-furanyl)- |
| Synonyms: | Adenine,9-(tetrahydro-2-furyl)- (7CI,8CI);9-(Tetrahydro-2-furyl)adenine;NSC 53339;SQ 22536;Tetrahydrofuryl-9-adenine;9-(Tetrahydrofuran-2-yl)-9H-purin-6-amine;9-(2-Tetrahydrofuryl)adenine;9-(Oxolan-2-yl)purin-6-amine; |
| CAS: | 17318-31-9 |
| Molecular Formula: | C9H11N5O |
| Molecular Weight: | 205.21654 |
| InChI: | InChI=1S/C9H11N5O/c10-8-7-9(12-4-11-8)14(5-13-7)6-2-1-3-15-6/h4-6H,1-3H2,(H2,10,11,12) |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 160-161ºC |
| Density: | 1.7 g/cm3 |
| Refractive index: | 1.83 |
| Water Solubility: | Soluble in DMSO or Water |
| Solubility: | Soluble in DMSO or Water |
| Appearance: | Off-White Solid |
| Biological Activity: | Inhibitor of adenylyl cyclase (IC 50 = 1.4 μ M). Inhibits PGE 1 -stimulated increases in cAMP levels in intact human platelets. |
| Storage Temperature: | 0-6°C |
| Color: | white to off-white |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |
