| Identification |
| Name: | 1,2-Dimethylimidazole |
| Synonyms: | 1H-Imidazole, 1,2-dimethyl-; |
| CAS: | 1739-84-0 |
| EINECS: | 217-101-2 |
| Molecular Formula: | C5H8N2 |
| Molecular Weight: | 96.13 |
| InChI: | InChI=1/C5H8N2/c1-5-6-3-4-7(5)2/h3-4H,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 25kgs |
| Density: | 1.084 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.4945 (25 C) |
| Water Solubility: | soluble (also in almost organic solvents) |
| Solubility: | soluble (also in almost organic solvents) |
| Appearance: | clear to white solid |
| Packinggroup: | III |
| HS Code: | 29332990 |
| Storage Temperature: | Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. Corrosives area. |
| Usage: | Vulcanizing agent. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
