| Identification | |
| Name: | 2-Allylphenol |
| Synonyms: | 2-(2-propenyl)-pheno; o-allyl-pheno; Phenol, o-allyl-; O-ALLYLPHENOL; 2-(2-propenyl)phenol; ALLYLPHENOL-2; 2-Allylphenol, 98+% |
| CAS: | 1745-81-9 |
| EINECS: | 217-119-0 |
| Molecular Formula: | C9H10O |
| Molecular Weight: | 134.18 |
| InChI: | InChI=1/C9H10O/c1-2-5-8-6-3-4-7-9(8)10/h2-4,6-7,10H,1,5H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2923 |
| Density: | 1.02 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.544-1.546 |
| Solubility: | 7 g/L (20 ºC) in water |
| Appearance: | clear colorless to light yellow liquid. |
| Specification: |
The extinguishing agent of 2-Allylphenol (CAS No. 1745-81-9) are dry powder, foam, sand, carbon dioxide, water mist. |
| Packinggroup: | III |
| HS Code: | 29071900 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
