| Identification | |
| Name: | Ethyl 3-benzoylacrylate |
| Synonyms: | Acrylicacid, 3-benzoyl-, ethyl ester (6CI,7CI,8CI);3-Benzoylacrylic acid ethyl ester;Ethyl 4-oxo-4-phenyl-2-butenoate;Ethyl4-phenyl-4-oxobutenoate;Trans ethyl 3-benzoylacrylate; |
| CAS: | 17450-56-5 |
| EINECS: | 408-040-4 |
| Molecular Formula: | C12H12O3 |
| Molecular Weight: | 204.22 |
| InChI: | InChI=1/C12H12O3/c1-2-15-12(14)9-8-11(13)10-6-4-3-5-7-10/h3-9H,2H2,1H3/b9-8+ |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN2810 |
| Density: | 1.112 |
| Refractive index: | 1.542-1.546 |
| Appearance: | pale yellow to pale red liquid |
| Specification: |
?Ethyl 3-benzoylacrylate (CAS NO.17450-56-5) also can be called Ethyl (2E)-4-oxo-4-phenyl-2-butenoate and 2-Butenoic acid, 4-oxo-4-phenyl-, ethyl ester . In addition, polymerization of?it is hazardous. |
| Packinggroup: | III |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
