| Identification | |
| Name: | Propanamide,2-(acetylamino)-3-methoxy-N-(phenylmethyl)-, (2R)- |
| Synonyms: | Propanamide,2-(acetylamino)-3-methoxy-N-(phenylmethyl)-, (R)-;ADD 243037;Erlosamide;Harkoseride;SPM 927; |
| CAS: | 175481-36-4 |
| Molecular Formula: | C13H18N2O3 |
| Molecular Weight: | 250.29 |
| InChI: | InChI=1/C13H18N2O3/c1-10(16)15-12(9-18-2)13(17)14-8-11-6-4-3-5-7-11/h3-7,12H,8-9H2,1-2H3,(H,14,17)(H,15,16)/t12-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.12 g/cm3 |
| Refractive index: | 1.52 |
| Specification: |
?Propanamide,2-(acetylamino)-3-methoxy-N-(phenylmethyl)-, (2R)- , its cas register number 175481-36-4. It also can be called?Lacosamide?; and?(R)-2-Acetamido-N-benzyl-3-methoxypropanamide . Its classification code are Anticonvulsant and Anticonvulsants. |
| Usage: | Propanamide,2-(acetylamino)-3-methoxy-N-(phenylmethyl)-, (2R)- (CAS NO.175481-36-4) can be used as a potent anticonvulsant. |
| Safety Data | |
 |
|
