Identification |
Name: | 1H-Indole-2-carboxamide,1-[(2S)-2-amino-1-oxobutyl]-N-butyl-2,3-dihydro-, (2S)- |
Synonyms: | 1H-Indole-2-carboxamide,1-(2-amino-1-oxobutyl)-N-butyl-2,3-dihydro-, [S-(R*,R*)]-; Butabindide; UCL1397 |
CAS: | 175553-48-7 |
Molecular Formula: | C17H25 N3 O2 |
Molecular Weight: | 393.43 |
InChI: | InChI=1/C17H25N3O2.C2H2O4/c1-3-5-10-19-16(21)15-11-12-8-6-7-9-14(12)20(15)17(22)13(18)4-2;3-1(4)2(5)6/h6-9,13,15H,3-5,10-11,18H2,1-2H3,(H,19,21);(H,3,4)(H,5,6)/t13?,15-;/m0./s1 |
Molecular Structure: |
![(C17H25N3O2) 1H-Indole-2-carboxamide,1-(2-amino-1-oxobutyl)-N-butyl-2,3-dihydro-, [S-(R*,R*)]-; Butabindide; UCL1...](https://img1.guidechem.com/chem/e/dict/27/175553-48-7.jpg) |
Properties |
Flash Point: | 402.1°C |
Boiling Point: | 741.2°Cat760mmHg |
Density: | g/cm3 |
Biological Activity: | Potent, reversible, selective and competitive inhibitor of a CCK-inactivating serine protease (tripeptidyl peptidase II) (K i = 7 nM). Active in vivo (ID 50 = 1.1 and 6.8 mg/kg i.v. for inhibition of liver and brain enzyme respectively). |
Flash Point: | 402.1°C |
Safety Data |
|
 |