| Identification | |
| Name: | Phenol,4-amino-3-chloro- |
| Synonyms: | 1-Hydroxy-4-amino-3-chlorobenzene;2-Chloro-4-hydroxyaniline; 3-Chloro-4-aminophenol; 3-Chloro-p-aminophenol;4-Amino-3-chlorophenol |
| CAS: | 17609-80-2 |
| EINECS: | 241-583-3 |
| Molecular Formula: | C6H6 Cl N O |
| Molecular Weight: | 143.57 |
| InChI: | InChI=1/C6H6ClNO/c7-5-3-4(9)1-2-6(5)8/h1-3,9H,8H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 127.6°C |
| Boiling Point: | 287.3°Cat760mmHg |
| Density: | 1.406g/cm3 |
| Refractive index: | 1.606 |
| Specification: |
Phenol,4-amino-3-chloro- with cas registry number of 17609-80-2 is also called 4-Amino-3-chlorophenol ; 3-13-00-01184 (Beilstein Handbook Reference) ; 3-Chloro-4-aminophenol . |
| Flash Point: | 127.6°C |
| Safety Data | |
 |
|
