| Identification | |
| Name: | 3,5-Bis(tert-butyl)benzaldehyde |
| Synonyms: | Benzaldehyde,3,5-di-tert-butyl- (6CI,7CI,8CI);3,5-Bis(1,1-dimethylethyl)benzaldehyde;3,5-Di-tert-butylbenzaldehyde; |
| CAS: | 17610-00-3 |
| Molecular Formula: | C15H22O |
| Molecular Weight: | 218.3346 |
| InChI: | InChI=1/C16H20BrNO2/c17-11-7-3-1-2-4-8-12-18-15(19)13-9-5-6-10-14(13)16(18)20/h5-6,9-10H,1-4,7-8,11-12H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.931 g/cm3 |
| Refractive index: | 1.567 |
| Appearance: | off-white powder |
| Specification: |
3,5-Bis(tert-butyl)benzaldehyde , with CAS number of 17610-00-3, can be called 3,5-Bis(tert-butyl)benzaldehyde ; 3,5-di-tert-butyl-benzaldehyde ; 3,5-bis(tert-butyl)benzaldehyde 97% ; 3,5-bis(tert-butyl)benzldehyde ; 3,5-Bis(tert-butyl)benzaldehyde,97% ; 3,5-Bis(tert-butyl)benzaldehyde3,5-Di-tert-butylbenzaldehyde . It is an off-white powder.Need to be stored in a cool, dry place. Handling of 3,5-Bis(tert-butyl)benzaldehyde (CAS NO.17610-00-3) is to avoid breathing dust, vapor, mist, or gas. Keep container tightly closed. Wash thoroughly after handling. Minimize dust generation and accumulation. Avoid ingestion and inhalation. Avoid contact with eyes, skin, and clothing. Use only in a chemical fume hood. |
| Safety Data | |
 |
|
