| Identification |
| Name: | Benzonitrile,3,4-diamino- |
| Synonyms: | 1,2-Diamino-4-cyanobenzene;2-Amino-4-cyanoaniline;4-Cyano-1,2-benzenediamine;4-Cyano-1,2-diaminobenzene;4-Cyano-1,2-phenylenediamine;4-Cyano-o-phenylenediamine; |
| CAS: | 17626-40-3 |
| Molecular Formula: | C7H7N3 |
| Molecular Weight: | 133.15 |
| InChI: | InChI=1/C7H7N3/c8-4-5-1-2-6(9)7(10)3-5/h1-3H,9-10H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 3276 |
| Flash Point: | 176.8°C |
| Boiling Point: | 368.7°Cat760mmHg |
| Density: | 1.24g/cm3 |
| Refractive index: | 1.64 |
| Appearance: | White to light yellow crystal powder |
| Specification: |
Removal in wastewater treatment of 3,4-diaminobenzonitrile (17626-40-3) can be stated as follows:
Total removal:1.85 percent
Total biodegradation:0.09 percent
Total sludge adsorption:1.76 percent
Total to Air:0.00 percent
(using 10000 hr Bio P,A,S)
|
| Flash Point: | 176.8°C |
| Usage: |
3,4-diaminobenzonitrile (17626-40-3) is usually used like synthetic intermediate.
|
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |