| Identification | |
| Name: | 1-Bromo-2,4-dimethoxybenzene |
| Synonyms: | 4-Bromoresorcinol dimethylether; 2,4-Dimethoxybromobenzene |
| CAS: | 17715-69-4 |
| EINECS: | 241-717-0 |
| Molecular Formula: | C8H9BrO2 |
| Molecular Weight: | 217.06 |
| InChI: | InChI=1/C8H9BrO2/c1-10-6-3-4-7(9)8(5-6)11-2/h3-5H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.507 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.5718-1.5738 |
| Water Solubility: | insoluble |
| Solubility: | insoluble in water |
| Appearance: | Clear very faint yellow liquid. Benzene-like odor. |
| Specification: |
1-Bromo-2,4-dimethoxybenzene (CAS NO.17715-69-4) should be stored in cool, dry conditions in well sealed containers. Store away from oxidizing agents, strong bases. |
| Storage Temperature: | 0-6°C |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
