| Identification | |
| Name: | Ethyldichlorosilane |
| Synonyms: | dichloroethyl-silan; Monoethyldichlorosilane; Silane, dichloroethyl-; DICHLOROETHYLSILANE |
| CAS: | 1789-58-8 |
| EINECS: | 217-255-0 |
| Molecular Formula: | C2H6Cl2Si |
| Molecular Weight: | 129.06 |
| InChI: | InChI=1/C2H6Cl2Si/c1-2-5(3)4/h5H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1183 4.3/PG 1 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | n20/D 1.415 |
| Solubility: | Reacts |
| Appearance: | A colorless fuming liquid with a pungent odor. |
| Specification: |
Dichloroethylsilane ,its CAS NO. is 1789-58-8,the synonyms is Dichloroethyl-silan ; Monoethyldichlorosilane ; Silane, dichloroethyl- ; Ethyldichlorosilane . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | I |
| Storage Temperature: | Refrigerator |
| Color: | Colorless liquid |
| Usage: | Chemical intermediate for silicones. |
| Safety Data | |
 |
|
