| Identification |
| Name: | Benzo[b]cyclopropa[e]pyran-1a(1H)-carboxylicacid, 7,7a-dihydro-7-(hydroxyimino)-, ethyl ester |
| Synonyms: | CPCCOEt |
| CAS: | 179067-99-3 |
| Molecular Formula: | C13H13 N O4 |
| Molecular Weight: | 247.25 |
| InChI: | InChI=1/C13H13NO4/c1-2-17-12(15)13-7-9(13)11(14-16)8-5-3-4-6-10(8)18-13/h3-6,9,16H,2,7H2,1H3/b14-11- |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 194.4°C |
| Boiling Point: | 397.8°Cat760mmHg |
| Density: | 1.42g/cm3 |
| Refractive index: | 1.644 |
| Biological Activity: | hmGlu 1 subtype-selective non-competitive antagonist (IC 50 = 6.5 μ M). Has no agonist or antagonist activity at hmGlu 2, 4a, 5a, 7b, 8a or ionotropic receptors at concentrations of up to 100 μ M. |
| Flash Point: | 194.4°C |
| Color: | white |
| Safety Data |
| |
 |
